C21H26O4 — CID 122367194
(2R,4S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxan-4-ol (PubChem CID 122367194) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R,4S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxan-4-ol.
| Compound Name | (2R,4S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxan-4-ol |
|---|---|
| PubChem CID | 122367194 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R,4S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxan-4-ol |
| SMILES | COc1ccc(CC[C@@H]2C[C@H](O)C[C@H](c3ccc(OC)cc3)O2)cc1 |
| InChI | InChI=1S/C21H26O4/c1-23-18-8-3-15(4-9-18)5-10-20-13-17(22)14-21(25-20)16-6-11-19(24-2)12-7-16/h3-4,6-9,11-12,17,20-22H,5,10,13-14H2,1-2H3/t17-,20+,21+/m0/s1 |
| InChIKey | YYHNMCPAVPZGPO-IOMROCGXSA-N |
| XLogP | 3.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |