C21H26O3 — CID 162820309
(2S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxane (PubChem CID 162820309) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxane.
| Compound Name | (2S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxane |
|---|---|
| PubChem CID | 162820309 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2S,6R)-2-(4-methoxyphenyl)-6-[2-(4-methoxyphenyl)ethyl]oxane |
| SMILES | COc1ccc(CC[C@H]2CCC[C@@H](c3ccc(OC)cc3)O2)cc1 |
| InChI | InChI=1S/C21H26O3/c1-22-18-11-6-16(7-12-18)8-13-20-4-3-5-21(24-20)17-9-14-19(23-2)15-10-17/h6-7,9-12,14-15,20-21H,3-5,8,13H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | SXKCFMYNSDVGSD-RTWAWAEBSA-N |
| XLogP | 4.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |