C17H17FO2 — CID 11807821
(2S,5R)-2-(4-fluorophenyl)-5-(4-methoxyphenyl)oxolane (PubChem CID 11807821) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is (2S,5R)-2-(4-fluorophenyl)-5-(4-methoxyphenyl)oxolane.
| Compound Name | (2S,5R)-2-(4-fluorophenyl)-5-(4-methoxyphenyl)oxolane |
|---|---|
| PubChem CID | 11807821 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2S,5R)-2-(4-fluorophenyl)-5-(4-methoxyphenyl)oxolane |
| SMILES | COc1ccc([C@H]2CC[C@@H](c3ccc(F)cc3)O2)cc1 |
| InChI | InChI=1S/C17H17FO2/c1-19-15-8-4-13(5-9-15)17-11-10-16(20-17)12-2-6-14(18)7-3-12/h2-9,16-17H,10-11H2,1H3/t16-,17+/m0/s1 |
| InChIKey | LGGFZCOSLIAAKR-DLBZAZTESA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |