C27H28O4 — CID 71726184
2-[(2S,6R)-6-(4-methoxyphenyl)oxan-2-yl]-1-(4-phenylmethoxyphenyl)ethanone (PubChem CID 71726184) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(2S,6R)-6-(4-methoxyphenyl)oxan-2-yl]-1-(4-phenylmethoxyphenyl)ethanone.
| Compound Name | 2-[(2S,6R)-6-(4-methoxyphenyl)oxan-2-yl]-1-(4-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 71726184 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[(2S,6R)-6-(4-methoxyphenyl)oxan-2-yl]-1-(4-phenylmethoxyphenyl)ethanone |
| SMILES | COc1ccc([C@H]2CCC[C@@H](CC(=O)c3ccc(OCc4ccccc4)cc3)O2)cc1 |
| InChI | InChI=1S/C27H28O4/c1-29-23-14-12-22(13-15-23)27-9-5-8-25(31-27)18-26(28)21-10-16-24(17-11-21)30-19-20-6-3-2-4-7-20/h2-4,6-7,10-17,25,27H,5,8-9,18-19H2,1H3/t25-,27+/m0/s1 |
| InChIKey | JLEJYMBEMSFSPK-AHKZPQOWSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |