C26H27NO4 — CID 112766807
1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone (PubChem CID 112766807) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone.
| Compound Name | 1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 112766807 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone |
| SMILES | COc1ccc(C2CCCN2C(=O)COc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-29-22-11-9-21(10-12-22)25-8-5-17-27(25)26(28)19-31-24-15-13-23(14-16-24)30-18-20-6-3-2-4-7-20/h2-4,6-7,9-16,25H,5,8,17-19H2,1H3 |
| InChIKey | NACRDQIXDNWAOL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |