C21H23NO3 — CID 51254000
1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione (PubChem CID 51254000) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 51254000 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione |
| SMILES | COc1ccc(C2CCCN2C(=O)CCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-25-18-11-9-16(10-12-18)19-8-5-15-22(19)21(24)14-13-20(23)17-6-3-2-4-7-17/h2-4,6-7,9-12,19H,5,8,13-15H2,1H3 |
| InChIKey | RFZQNOSNNSIASC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |