C18H28O3 — CID 57282111
2-[2-(4-methoxyphenyl)ethyl]-5-pentyl-1,4-dioxane (PubChem CID 57282111) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]-5-pentyl-1,4-dioxane.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]-5-pentyl-1,4-dioxane |
|---|---|
| PubChem CID | 57282111 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]-5-pentyl-1,4-dioxane |
| SMILES | CCCCCC1COC(CCc2ccc(OC)cc2)CO1 |
| InChI | InChI=1S/C18H28O3/c1-3-4-5-6-17-13-21-18(14-20-17)12-9-15-7-10-16(19-2)11-8-15/h7-8,10-11,17-18H,3-6,9,12-14H2,1-2H3 |
| InChIKey | DCXBXURNICZFIU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|