C27H38O2 — CID 54258152
(2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-heptyl-1,4-dioxane (PubChem CID 54258152) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is (2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-heptyl-1,4-dioxane.
| Compound Name | (2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-heptyl-1,4-dioxane |
|---|---|
| PubChem CID | 54258152 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-heptyl-1,4-dioxane |
| SMILES | CCCCCCC[C@H]1CO[C@H](c2ccc(-c3ccc(CCCC)cc3)cc2)CO1 |
| InChI | InChI=1S/C27H38O2/c1-3-5-7-8-9-11-26-20-29-27(21-28-26)25-18-16-24(17-19-25)23-14-12-22(13-15-23)10-6-4-2/h12-19,26-27H,3-11,20-21H2,1-2H3/t26-,27-/m0/s1 |
| InChIKey | RBNLKXVXPKKQCH-SVBPBHIXSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|