C28H38O2 — CID 70419534
(2R,5S)-2-butyl-5-[4-[4-(4-ethylcyclohexyl)phenyl]phenyl]-1,4-dioxane (PubChem CID 70419534) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is (2R,5S)-2-butyl-5-[4-[4-(4-ethylcyclohexyl)phenyl]phenyl]-1,4-dioxane.
| Compound Name | (2R,5S)-2-butyl-5-[4-[4-(4-ethylcyclohexyl)phenyl]phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 70419534 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (2R,5S)-2-butyl-5-[4-[4-(4-ethylcyclohexyl)phenyl]phenyl]-1,4-dioxane |
| SMILES | CCCC[C@@H]1CO[C@@H](c2ccc(-c3ccc(C4CCC(CC)CC4)cc3)cc2)CO1 |
| InChI | InChI=1S/C28H38O2/c1-3-5-6-27-19-30-28(20-29-27)26-17-15-25(16-18-26)24-13-11-23(12-14-24)22-9-7-21(4-2)8-10-22/h11-18,21-22,27-28H,3-10,19-20H2,1-2H3/t21?,22?,27-,28-/m1/s1 |
| InChIKey | XAZPHTNMJZGGML-LQRCLESYSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |