C29H40O2 — CID 70419032
(2R,5S)-2-butyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]-1,4-dioxane (PubChem CID 70419032) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (2R,5S)-2-butyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]-1,4-dioxane.
| Compound Name | (2R,5S)-2-butyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 70419032 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (2R,5S)-2-butyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]-1,4-dioxane |
| SMILES | CCCC[C@@H]1CO[C@@H](c2ccc(-c3ccc(C4CCC(CCC)CC4)cc3)cc2)CO1 |
| InChI | InChI=1S/C29H40O2/c1-3-5-7-28-20-31-29(21-30-28)27-18-16-26(17-19-27)25-14-12-24(13-15-25)23-10-8-22(6-4-2)9-11-23/h12-19,22-23,28-29H,3-11,20-21H2,1-2H3/t22?,23?,28-,29-/m1/s1 |
| InChIKey | PISRZDWREDAXSX-ZOBUQDIBSA-N |
| XLogP | 8.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |