C23H30O2 — CID 54058550
(2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-propyl-1,4-dioxane (PubChem CID 54058550) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-propyl-1,4-dioxane.
| Compound Name | (2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-propyl-1,4-dioxane |
|---|---|
| PubChem CID | 54058550 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (2R,5S)-2-[4-(4-butylphenyl)phenyl]-5-propyl-1,4-dioxane |
| SMILES | CCCCc1ccc(-c2ccc([C@@H]3CO[C@@H](CCC)CO3)cc2)cc1 |
| InChI | InChI=1S/C23H30O2/c1-3-5-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)23-17-24-22(6-4-2)16-25-23/h8-15,22-23H,3-7,16-17H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | LXZSZZILHXLIHZ-GOTSBHOMSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |