C20H21NO2 — CID 70419836
4-[4-[(2S,5R)-5-propyl-1,4-dioxan-2-yl]phenyl]benzonitrile (PubChem CID 70419836) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[4-[(2S,5R)-5-propyl-1,4-dioxan-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(2S,5R)-5-propyl-1,4-dioxan-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 70419836 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-[4-[(2S,5R)-5-propyl-1,4-dioxan-2-yl]phenyl]benzonitrile |
| SMILES | CCC[C@@H]1CO[C@@H](c2ccc(-c3ccc(C#N)cc3)cc2)CO1 |
| InChI | InChI=1S/C20H21NO2/c1-2-3-19-13-23-20(14-22-19)18-10-8-17(9-11-18)16-6-4-15(12-21)5-7-16/h4-11,19-20H,2-3,13-14H2,1H3/t19-,20-/m1/s1 |
| InChIKey | NBRVDWFIPCSTEX-WOJBJXKFSA-N |
| XLogP | 4.48 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |