C28H37F3O3 — CID 57261176
2-octyl-5-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]-1,4-dioxane (PubChem CID 57261176) has the molecular formula C28H37F3O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-octyl-5-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]-1,4-dioxane.
| Compound Name | 2-octyl-5-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 57261176 |
| Molecular Formula | C28H37F3O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-octyl-5-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]-1,4-dioxane |
| SMILES | CCCCCCCCC1COC(c2ccc(-c3ccc(OCCCC(F)(F)F)cc3)cc2)CO1 |
| InChI | InChI=1S/C28H37F3O3/c1-2-3-4-5-6-7-9-26-20-34-27(21-33-26)24-12-10-22(11-13-24)23-14-16-25(17-15-23)32-19-8-18-28(29,30)31/h10-17,26-27H,2-9,18-21H2,1H3 |
| InChIKey | GKUFTKCYZFLTTI-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|