C17H26O3 — CID 56985912
2-butyl-5-(4-propoxyphenyl)-1,4-dioxane (PubChem CID 56985912) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-butyl-5-(4-propoxyphenyl)-1,4-dioxane.
| Compound Name | 2-butyl-5-(4-propoxyphenyl)-1,4-dioxane |
|---|---|
| PubChem CID | 56985912 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-butyl-5-(4-propoxyphenyl)-1,4-dioxane |
| SMILES | CCCCC1COC(c2ccc(OCCC)cc2)CO1 |
| InChI | InChI=1S/C17H26O3/c1-3-5-6-16-12-20-17(13-19-16)14-7-9-15(10-8-14)18-11-4-2/h7-10,16-17H,3-6,11-13H2,1-2H3 |
| InChIKey | FLSKPIZKZPFEFK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |