C24H29NO2 — CID 70418834
4-[4-[(2S,5R)-5-heptyl-1,4-dioxan-2-yl]phenyl]benzonitrile (PubChem CID 70418834) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-[4-[(2S,5R)-5-heptyl-1,4-dioxan-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(2S,5R)-5-heptyl-1,4-dioxan-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 70418834 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-[4-[(2S,5R)-5-heptyl-1,4-dioxan-2-yl]phenyl]benzonitrile |
| SMILES | CCCCCCC[C@@H]1CO[C@@H](c2ccc(-c3ccc(C#N)cc3)cc2)CO1 |
| InChI | InChI=1S/C24H29NO2/c1-2-3-4-5-6-7-23-17-27-24(18-26-23)22-14-12-21(13-15-22)20-10-8-19(16-25)9-11-20/h8-15,23-24H,2-7,17-18H2,1H3/t23-,24-/m1/s1 |
| InChIKey | FSHYPXDFORLRIV-DNQXCXABSA-N |
| XLogP | 6.04 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|