C17H23NO2 — CID 11970631
4-(5-hexyl-1,3-dioxan-2-yl)benzonitrile (PubChem CID 11970631) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-(5-hexyl-1,3-dioxan-2-yl)benzonitrile.
| Compound Name | 4-(5-hexyl-1,3-dioxan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 11970631 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-(5-hexyl-1,3-dioxan-2-yl)benzonitrile |
| SMILES | CCCCCCC1COC(c2ccc(C#N)cc2)OC1 |
| InChI | InChI=1S/C17H23NO2/c1-2-3-4-5-6-15-12-19-17(20-13-15)16-9-7-14(11-18)8-10-16/h7-10,15,17H,2-6,12-13H2,1H3 |
| InChIKey | OGCKMDSDEJZJIZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|