C16H22BNO2 — CID 14437609
4-(5-hexyl-1,3,2-dioxaborinan-2-yl)benzonitrile (PubChem CID 14437609) has the molecular formula C16H22BNO2 and a molecular weight of 271.17 g/mol. Its IUPAC name is 4-(5-hexyl-1,3,2-dioxaborinan-2-yl)benzonitrile.
| Compound Name | 4-(5-hexyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 14437609 |
| Molecular Formula | C16H22BNO2 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-(5-hexyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| SMILES | CCCCCCC1COB(c2ccc(C#N)cc2)OC1 |
| InChI | InChI=1S/C16H22BNO2/c1-2-3-4-5-6-15-12-19-17(20-13-15)16-9-7-14(11-18)8-10-16/h7-10,15H,2-6,12-13H2,1H3 |
| InChIKey | PDPHPHPLWJUUKE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|