C22H27BCl2O2 — CID 139617290
2-[4-(3,5-dichlorophenyl)phenyl]-5-heptyl-1,3,2-dioxaborinane (PubChem CID 139617290) has the molecular formula C22H27BCl2O2 and a molecular weight of 405.17 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorophenyl)phenyl]-5-heptyl-1,3,2-dioxaborinane.
| Compound Name | 2-[4-(3,5-dichlorophenyl)phenyl]-5-heptyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139617290 |
| Molecular Formula | C22H27BCl2O2 |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[4-(3,5-dichlorophenyl)phenyl]-5-heptyl-1,3,2-dioxaborinane |
| SMILES | CCCCCCCC1COB(c2ccc(-c3cc(Cl)cc(Cl)c3)cc2)OC1 |
| InChI | InChI=1S/C22H27BCl2O2/c1-2-3-4-5-6-7-17-15-26-23(27-16-17)20-10-8-18(9-11-20)19-12-21(24)14-22(25)13-19/h8-14,17H,2-7,15-16H2,1H3 |
| InChIKey | VYGJHAJTQDOROK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|