C16H21BF4O3 — CID 139609117
2-[3-fluoro-4-(trifluoromethoxy)phenyl]-5-hexyl-1,3,2-dioxaborinane (PubChem CID 139609117) has the molecular formula C16H21BF4O3 and a molecular weight of 348.15 g/mol. Its IUPAC name is 2-[3-fluoro-4-(trifluoromethoxy)phenyl]-5-hexyl-1,3,2-dioxaborinane.
| Compound Name | 2-[3-fluoro-4-(trifluoromethoxy)phenyl]-5-hexyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139609117 |
| Molecular Formula | C16H21BF4O3 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[3-fluoro-4-(trifluoromethoxy)phenyl]-5-hexyl-1,3,2-dioxaborinane |
| SMILES | CCCCCCC1COB(c2ccc(OC(F)(F)F)c(F)c2)OC1 |
| InChI | InChI=1S/C16H21BF4O3/c1-2-3-4-5-6-12-10-22-17(23-11-12)13-7-8-15(14(18)9-13)24-16(19,20)21/h7-9,12H,2-6,10-11H2,1H3 |
| InChIKey | HYBZFDPIVPNVQU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|