C17H24BF3O4 — CID 139609166
5-(hexoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborinane (PubChem CID 139609166) has the molecular formula C17H24BF3O4 and a molecular weight of 360.18 g/mol. Its IUPAC name is 5-(hexoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborinane.
| Compound Name | 5-(hexoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139609166 |
| Molecular Formula | C17H24BF3O4 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5-(hexoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1,3,2-dioxaborinane |
| SMILES | CCCCCCOCC1COB(c2ccc(OC(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C17H24BF3O4/c1-2-3-4-5-10-22-11-14-12-23-18(24-13-14)15-6-8-16(9-7-15)25-17(19,20)21/h6-9,14H,2-5,10-13H2,1H3 |
| InChIKey | LQTRIJSAOVVXNW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|