C24H30BFO4 — CID 10501811
(4aR,6R,8aS)-6-(4-fluorophenyl)-2-(4-hexoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaborinine (PubChem CID 10501811) has the molecular formula C24H30BFO4 and a molecular weight of 412.31 g/mol. Its IUPAC name is (4aR,6R,8aS)-6-(4-fluorophenyl)-2-(4-hexoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaborinine.
| Compound Name | (4aR,6R,8aS)-6-(4-fluorophenyl)-2-(4-hexoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaborinine |
|---|---|
| PubChem CID | 10501811 |
| Molecular Formula | C24H30BFO4 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (4aR,6R,8aS)-6-(4-fluorophenyl)-2-(4-hexoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaborinine |
| SMILES | CCCCCCOc1ccc(B2OC[C@H]3O[C@@H](c4ccc(F)cc4)CC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C24H30BFO4/c1-2-3-4-5-16-27-21-12-8-19(9-13-21)25-28-17-24-23(30-25)15-14-22(29-24)18-6-10-20(26)11-7-18/h6-13,22-24H,2-5,14-17H2,1H3/t22-,23+,24-/m1/s1 |
| InChIKey | XRSCKXIXHAFHQD-TZRRMPRUSA-N |
| XLogP | 4.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|