C23H27ClO4 — CID 10549132
(2R,4aR,6R,8aS)-2-(4-butoxyphenyl)-6-(4-chlorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10549132) has the molecular formula C23H27ClO4 and a molecular weight of 402.92 g/mol. Its IUPAC name is (2R,4aR,6R,8aS)-2-(4-butoxyphenyl)-6-(4-chlorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6R,8aS)-2-(4-butoxyphenyl)-6-(4-chlorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10549132 |
| Molecular Formula | C23H27ClO4 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2R,4aR,6R,8aS)-2-(4-butoxyphenyl)-6-(4-chlorophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCOc1ccc([C@@H]2OC[C@H]3O[C@@H](c4ccc(Cl)cc4)CC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C23H27ClO4/c1-2-3-14-25-19-10-6-17(7-11-19)23-26-15-22-21(28-23)13-12-20(27-22)16-4-8-18(24)9-5-16/h4-11,20-23H,2-3,12-15H2,1H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | FOSPYHMLNKNCRT-KAOXLYBCSA-N |
| XLogP | 5.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|