C18H24O5 — CID 11034557
(1R,3S,4S,6S,9S,11R)-3-ethyl-11-(4-methoxyphenyl)-2,5,10,12-tetraoxatricyclo[7.4.0.04,6]tridecane (PubChem CID 11034557) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is (1R,3S,4S,6S,9S,11R)-3-ethyl-11-(4-methoxyphenyl)-2,5,10,12-tetraoxatricyclo[7.4.0.04,6]tridecane.
| Compound Name | (1R,3S,4S,6S,9S,11R)-3-ethyl-11-(4-methoxyphenyl)-2,5,10,12-tetraoxatricyclo[7.4.0.04,6]tridecane |
|---|---|
| PubChem CID | 11034557 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (1R,3S,4S,6S,9S,11R)-3-ethyl-11-(4-methoxyphenyl)-2,5,10,12-tetraoxatricyclo[7.4.0.04,6]tridecane |
| SMILES | CC[C@@H]1O[C@@H]2CO[C@@H](c3ccc(OC)cc3)O[C@H]2CC[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C18H24O5/c1-3-13-17-15(22-17)9-8-14-16(21-13)10-20-18(23-14)11-4-6-12(19-2)7-5-11/h4-7,13-18H,3,8-10H2,1-2H3/t13-,14-,15-,16+,17+,18+/m0/s1 |
| InChIKey | RGDUTQVGQOGNQB-SJUNHDGSSA-N |
| XLogP | 2.83 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|