C22H32O7Si — CID 16720996
methyl 2-[(2R,4aR,6S,10aS)-2-(4-methoxyphenyl)-7-oxo-8-trimethylsilyl-4,4a,8,9,10,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-6-yl]acetate (PubChem CID 16720996) has the molecular formula C22H32O7Si and a molecular weight of 436.58 g/mol. Its IUPAC name is methyl 2-[(2R,4aR,6S,10aS)-2-(4-methoxyphenyl)-7-oxo-8-trimethylsilyl-4,4a,8,9,10,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-6-yl]acetate.
| Compound Name | methyl 2-[(2R,4aR,6S,10aS)-2-(4-methoxyphenyl)-7-oxo-8-trimethylsilyl-4,4a,8,9,10,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-6-yl]acetate |
|---|---|
| PubChem CID | 16720996 |
| Molecular Formula | C22H32O7Si |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | methyl 2-[(2R,4aR,6S,10aS)-2-(4-methoxyphenyl)-7-oxo-8-trimethylsilyl-4,4a,8,9,10,10a-hexahydro-[1,3]dioxino[5,4-b]oxocin-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@H]2CO[C@@H](c3ccc(OC)cc3)O[C@H]2CCC([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C22H32O7Si/c1-25-15-8-6-14(7-9-15)22-27-13-18-16(29-22)10-11-19(30(3,4)5)21(24)17(28-18)12-20(23)26-2/h6-9,16-19,22H,10-13H2,1-5H3/t16-,17-,18+,19?,22+/m0/s1 |
| InChIKey | FPNWJHMODKKXTD-VKKCSBIKSA-N |
| XLogP | 3.50 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|