C22H22O5 — CID 71665514
2-[(4aR,6S,8aS)-2-(4-methoxyphenyl)-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylethanone (PubChem CID 71665514) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[(4aR,6S,8aS)-2-(4-methoxyphenyl)-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylethanone.
| Compound Name | 2-[(4aR,6S,8aS)-2-(4-methoxyphenyl)-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 71665514 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[(4aR,6S,8aS)-2-(4-methoxyphenyl)-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylethanone |
| SMILES | COc1ccc(C2OC[C@H]3O[C@@H](CC(=O)c4ccccc4)C=C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C22H22O5/c1-24-17-9-7-16(8-10-17)22-25-14-21-20(27-22)12-11-18(26-21)13-19(23)15-5-3-2-4-6-15/h2-12,18,20-22H,13-14H2,1H3/t18-,20+,21-,22?/m1/s1 |
| InChIKey | NLBSUBODLIITKH-LXGGTWNRSA-N |
| XLogP | 3.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|