C20H20O4 — CID 51063373
(4aR,6S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine (PubChem CID 51063373) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (4aR,6S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 51063373 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (4aR,6S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C1=C[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H20O4/c1-3-7-15(8-4-1)13-21-19-12-11-17-18(23-19)14-22-20(24-17)16-9-5-2-6-10-16/h1-12,17-20H,13-14H2/t17-,18+,19-,20?/m0/s1 |
| InChIKey | GDQMHVMECKRXBA-COHPWVSRSA-N |
| XLogP | 3.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|