C21H30O4 — CID 102020103
(4aR,6R,8aS)-6-octoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine (PubChem CID 102020103) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (4aR,6R,8aS)-6-octoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,8aS)-6-octoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 102020103 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (4aR,6R,8aS)-6-octoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCCCCCO[C@H]1C=C[C@@H]2OC(c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C21H30O4/c1-2-3-4-5-6-10-15-22-20-14-13-18-19(24-20)16-23-21(25-18)17-11-8-7-9-12-17/h7-9,11-14,18-21H,2-6,10,15-16H2,1H3/t18-,19+,20+,21?/m0/s1 |
| InChIKey | XOVALKWLOKMKMC-HVZPKCFKSA-N |
| XLogP | 4.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|