C17H31BO4 — CID 611304
2-ethyl-6-nonoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxaborinine (PubChem CID 611304) has the molecular formula C17H31BO4 and a molecular weight of 310.24 g/mol. Its IUPAC name is 2-ethyl-6-nonoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxaborinine.
| Compound Name | 2-ethyl-6-nonoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxaborinine |
|---|---|
| PubChem CID | 611304 |
| Molecular Formula | C17H31BO4 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 2-ethyl-6-nonoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxaborinine |
| SMILES | CCCCCCCCCOC1C=CC2OB(CC)OCC2O1 |
| InChI | InChI=1S/C17H31BO4/c1-3-5-6-7-8-9-10-13-19-17-12-11-15-16(21-17)14-20-18(4-2)22-15/h11-12,15-17H,3-10,13-14H2,1-2H3 |
| InChIKey | BFCZOJCCQDVMIV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|