C9H16O2 — CID 126664173
(1S,5R)-3-butoxy-6-oxabicyclo[3.1.0]hexane (PubChem CID 126664173) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (1S,5R)-3-butoxy-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-butoxy-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 126664173 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (1S,5R)-3-butoxy-6-oxabicyclo[3.1.0]hexane |
| SMILES | CCCCOC1C[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-10-7-5-8-9(6-7)11-8/h7-9H,2-6H2,1H3/t7?,8-,9+ |
| InChIKey | YAFFYDXXMZUTET-CBLAIPOGSA-N |
| XLogP | 1.73 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|