C12H19F3O3 — CID 22880101
(2S,3S,6R)-6-hexoxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 22880101) has the molecular formula C12H19F3O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is (2S,3S,6R)-6-hexoxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3S,6R)-6-hexoxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 22880101 |
| Molecular Formula | C12H19F3O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2S,3S,6R)-6-hexoxy-2-(trifluoromethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCCCCCO[C@H]1C=C[C@H](O)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C12H19F3O3/c1-2-3-4-5-8-17-10-7-6-9(16)11(18-10)12(13,14)15/h6-7,9-11,16H,2-5,8H2,1H3/t9-,10+,11-/m0/s1 |
| InChIKey | JHMBUXXZCWILDA-AXFHLTTASA-N |
| XLogP | 2.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|