C14H27FO5 — CID 11687942
(2R,3R,4R,5R)-2-[(1S)-2-fluoro-1-hydroxyethyl]-5-octoxyoxolane-3,4-diol (PubChem CID 11687942) has the molecular formula C14H27FO5 and a molecular weight of 294.36 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[(1S)-2-fluoro-1-hydroxyethyl]-5-octoxyoxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[(1S)-2-fluoro-1-hydroxyethyl]-5-octoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 11687942 |
| Molecular Formula | C14H27FO5 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2R,3R,4R,5R)-2-[(1S)-2-fluoro-1-hydroxyethyl]-5-octoxyoxolane-3,4-diol |
| SMILES | CCCCCCCCO[C@@H]1O[C@@H]([C@H](O)CF)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H27FO5/c1-2-3-4-5-6-7-8-19-14-12(18)11(17)13(20-14)10(16)9-15/h10-14,16-18H,2-9H2,1H3/t10-,11-,12-,13+,14-/m1/s1 |
| InChIKey | YJRNRWDYDVAKER-XGFWRYKXSA-N |
| XLogP | 1.14 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|