C20H38O11 — CID 102407270
(2S,3R,4R,5R)-2-[(1R)-1,2-dihydroxyethyl]-5-[(1R)-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-octoxyoxolan-2-yl]-2-hydroxyethoxy]oxolane-3,4-diol (PubChem CID 102407270) has the molecular formula C20H38O11 and a molecular weight of 454.51 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-[(1R)-1,2-dihydroxyethyl]-5-[(1R)-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-octoxyoxolan-2-yl]-2-hydroxyethoxy]oxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-[(1R)-1,2-dihydroxyethyl]-5-[(1R)-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-octoxyoxolan-2-yl]-2-hydroxyethoxy]oxolane-3,4-diol |
|---|---|
| PubChem CID | 102407270 |
| Molecular Formula | C20H38O11 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (2S,3R,4R,5R)-2-[(1R)-1,2-dihydroxyethyl]-5-[(1R)-1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-octoxyoxolan-2-yl]-2-hydroxyethoxy]oxolane-3,4-diol |
| SMILES | CCCCCCCCO[C@@H]1O[C@@H]([C@@H](CO)O[C@@H]2O[C@@H]([C@H](O)CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H38O11/c1-2-3-4-5-6-7-8-28-19-15(26)14(25)18(31-19)12(10-22)29-20-16(27)13(24)17(30-20)11(23)9-21/h11-27H,2-10H2,1H3/t11-,12-,13-,14-,15-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | LTKWNSOGPIVZEA-KYDCSHBKSA-N |
| XLogP | -2.01 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|