C19H37NO5 — CID 59900204
(2R,3S,5R,6S)-5-amino-4-decoxy-2-(hydroxymethyl)-6-[(Z)-prop-1-enoxy]oxan-3-ol (PubChem CID 59900204) has the molecular formula C19H37NO5 and a molecular weight of 359.51 g/mol. Its IUPAC name is (2R,3S,5R,6S)-5-amino-4-decoxy-2-(hydroxymethyl)-6-[(Z)-prop-1-enoxy]oxan-3-ol.
| Compound Name | (2R,3S,5R,6S)-5-amino-4-decoxy-2-(hydroxymethyl)-6-[(Z)-prop-1-enoxy]oxan-3-ol |
|---|---|
| PubChem CID | 59900204 |
| Molecular Formula | C19H37NO5 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | (2R,3S,5R,6S)-5-amino-4-decoxy-2-(hydroxymethyl)-6-[(Z)-prop-1-enoxy]oxan-3-ol |
| SMILES | C/C=C\O[C@H]1O[C@H](CO)[C@@H](O)C(OCCCCCCCCCC)[C@H]1N |
| InChI | InChI=1S/C19H37NO5/c1-3-5-6-7-8-9-10-11-13-23-18-16(20)19(24-12-4-2)25-15(14-21)17(18)22/h4,12,15-19,21-22H,3,5-11,13-14,20H2,1-2H3/b12-4-/t15-,16-,17-,18?,19+/m1/s1 |
| InChIKey | WEOBQAOGYDWVIU-HKDUDHRQSA-N |
| XLogP | 2.47 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|