C26H34O6 — CID 59848177
2-phenyl-5-[6-[(2-phenyl-1,3-dioxan-5-yl)oxy]hexoxy]-1,3-dioxane (PubChem CID 59848177) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-phenyl-5-[6-[(2-phenyl-1,3-dioxan-5-yl)oxy]hexoxy]-1,3-dioxane.
| Compound Name | 2-phenyl-5-[6-[(2-phenyl-1,3-dioxan-5-yl)oxy]hexoxy]-1,3-dioxane |
|---|---|
| PubChem CID | 59848177 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-phenyl-5-[6-[(2-phenyl-1,3-dioxan-5-yl)oxy]hexoxy]-1,3-dioxane |
| SMILES | c1ccc(C2OCC(OCCCCCCOC3COC(c4ccccc4)OC3)CO2)cc1 |
| InChI | InChI=1S/C26H34O6/c1(9-15-27-23-17-29-25(30-18-23)21-11-5-3-6-12-21)2-10-16-28-24-19-31-26(32-20-24)22-13-7-4-8-14-22/h3-8,11-14,23-26H,1-2,9-10,15-20H2 |
| InChIKey | OGRULZBRVOOSQT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|