C16H23BrO2 — CID 58676112
5-(6-bromohexyl)-2-phenyl-1,3-dioxane (PubChem CID 58676112) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 5-(6-bromohexyl)-2-phenyl-1,3-dioxane.
| Compound Name | 5-(6-bromohexyl)-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 58676112 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-(6-bromohexyl)-2-phenyl-1,3-dioxane |
| SMILES | BrCCCCCCC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C16H23BrO2/c17-11-7-2-1-4-8-14-12-18-16(19-13-14)15-9-5-3-6-10-15/h3,5-6,9-10,14,16H,1-2,4,7-8,11-13H2 |
| InChIKey | JCFKKYMZDCTLQN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|