C16H21ClO3 — CID 14745755
4-(5-pentyl-1,3-dioxan-2-yl)benzoyl chloride (PubChem CID 14745755) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 4-(5-pentyl-1,3-dioxan-2-yl)benzoyl chloride.
| Compound Name | 4-(5-pentyl-1,3-dioxan-2-yl)benzoyl chloride |
|---|---|
| PubChem CID | 14745755 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(5-pentyl-1,3-dioxan-2-yl)benzoyl chloride |
| SMILES | CCCCCC1COC(c2ccc(C(=O)Cl)cc2)OC1 |
| InChI | InChI=1S/C16H21ClO3/c1-2-3-4-5-12-10-19-16(20-11-12)14-8-6-13(7-9-14)15(17)18/h6-9,12,16H,2-5,10-11H2,1H3 |
| InChIKey | PVVYPCNCYFHXBV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|