C18H25F3O2 — CID 19021195
5-heptyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxane (PubChem CID 19021195) has the molecular formula C18H25F3O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-heptyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxane.
| Compound Name | 5-heptyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 19021195 |
| Molecular Formula | C18H25F3O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 5-heptyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxane |
| SMILES | CCCCCCCC1COC(c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C18H25F3O2/c1-2-3-4-5-6-7-14-12-22-17(23-13-14)15-8-10-16(11-9-15)18(19,20)21/h8-11,14,17H,2-7,12-13H2,1H3 |
| InChIKey | ZCCUVXJQVWCJCH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|