C15H21BrO2 — CID 5194456
2-(4-bromophenyl)-5-pentyl-1,3-dioxane (PubChem CID 5194456) has the molecular formula C15H21BrO2 and a molecular weight of 313.23 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-pentyl-1,3-dioxane.
| Compound Name | 2-(4-bromophenyl)-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 5194456 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(4-bromophenyl)-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(Br)cc2)OC1 |
| InChI | InChI=1S/C15H21BrO2/c1-2-3-4-5-12-10-17-15(18-11-12)13-6-8-14(16)9-7-13/h6-9,12,15H,2-5,10-11H2,1H3 |
| InChIKey | PTIXZQLHAOJXKF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|