C19H26F2O2 — CID 20599688
2-[4-(4,4-difluorobut-3-enyl)phenyl]-5-pentyl-1,3-dioxane (PubChem CID 20599688) has the molecular formula C19H26F2O2 and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-[4-(4,4-difluorobut-3-enyl)phenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-(4,4-difluorobut-3-enyl)phenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 20599688 |
| Molecular Formula | C19H26F2O2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-[4-(4,4-difluorobut-3-enyl)phenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(CCC=C(F)F)cc2)OC1 |
| InChI | InChI=1S/C19H26F2O2/c1-2-3-4-6-16-13-22-19(23-14-16)17-11-9-15(10-12-17)7-5-8-18(20)21/h8-12,16,19H,2-7,13-14H2,1H3 |
| InChIKey | LNCNMWNWLWKNSI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|