C28H34F2O4 — CID 20599505
2-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane (PubChem CID 20599505) has the molecular formula C28H34F2O4 and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane.
| Compound Name | 2-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599505 |
| Molecular Formula | C28H34F2O4 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane |
| SMILES | CCCCCC1COC(C2COC(c3ccc(-c4ccc(CC=C(F)F)cc4)cc3)OC2)OC1 |
| InChI | InChI=1S/C28H34F2O4/c1-2-3-4-5-21-16-31-28(32-17-21)25-18-33-27(34-19-25)24-13-11-23(12-14-24)22-9-6-20(7-10-22)8-15-26(29)30/h6-7,9-15,21,25,27-28H,2-5,8,16-19H2,1H3 |
| InChIKey | YIBNQVRZVZCMHM-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|