C28H32F2O2 — CID 20599723
5-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-2-(4-prop-2-enylcyclohexyl)-1,3-dioxane (PubChem CID 20599723) has the molecular formula C28H32F2O2 and a molecular weight of 438.56 g/mol. Its IUPAC name is 5-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-2-(4-prop-2-enylcyclohexyl)-1,3-dioxane.
| Compound Name | 5-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-2-(4-prop-2-enylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599723 |
| Molecular Formula | C28H32F2O2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 5-[4-[4-(3,3-difluoroprop-2-enyl)phenyl]phenyl]-2-(4-prop-2-enylcyclohexyl)-1,3-dioxane |
| SMILES | C=CCC1CCC(C2OCC(c3ccc(-c4ccc(CC=C(F)F)cc4)cc3)CO2)CC1 |
| InChI | InChI=1S/C28H32F2O2/c1-2-3-20-6-11-25(12-7-20)28-31-18-26(19-32-28)24-15-13-23(14-16-24)22-9-4-21(5-10-22)8-17-27(29)30/h2,4-5,9-10,13-17,20,25-26,28H,1,3,6-8,11-12,18-19H2 |
| InChIKey | AKGJFJCMVQYEJY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|