C24H38F2O — CID 20599924
2-(2,2-difluoroethenyl)-5-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]oxane (PubChem CID 20599924) has the molecular formula C24H38F2O and a molecular weight of 380.56 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]oxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 20599924 |
| Molecular Formula | C24H38F2O |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[4-[2-(4-prop-2-enylcyclohexyl)ethyl]cyclohexyl]oxane |
| SMILES | C=CCC1CCC(CCC2CCC(C3CCC(C=C(F)F)OC3)CC2)CC1 |
| InChI | InChI=1S/C24H38F2O/c1-2-3-18-4-6-19(7-5-18)8-9-20-10-12-21(13-11-20)22-14-15-23(27-17-22)16-24(25)26/h2,16,18-23H,1,3-15,17H2 |
| InChIKey | MYIZQJHBPVIIJH-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|