C22H34F2O — CID 20599472
2-(2,2-difluoroethenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]oxane (PubChem CID 20599472) has the molecular formula C22H34F2O and a molecular weight of 352.51 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]oxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 20599472 |
| Molecular Formula | C22H34F2O |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]oxane |
| SMILES | C/C=C/C1CCC(C2CCC(C3CCC(C=C(F)F)OC3)CC2)CC1 |
| InChI | InChI=1S/C22H34F2O/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-13-21(25-15-20)14-22(23)24/h2-3,14,16-21H,4-13,15H2,1H3/b3-2+ |
| InChIKey | PQKALKVNROGKTH-NSCUHMNNSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|