C26H40F2O2 — CID 20599587
2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane (PubChem CID 20599587) has the molecular formula C26H40F2O2 and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599587 |
| Molecular Formula | C26H40F2O2 |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane |
| SMILES | C=CC1CCC(C2COC(C3CCC(C4CCC(C=C(F)F)CC4)CC3)OC2)CC1 |
| InChI | InChI=1S/C26H40F2O2/c1-2-18-3-7-22(8-4-18)24-16-29-26(30-17-24)23-13-11-21(12-14-23)20-9-5-19(6-10-20)15-25(27)28/h2,15,18-24,26H,1,3-14,16-17H2 |
| InChIKey | GSHRGUUZXRQIHA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|