C23H36F2O — CID 130414821
1-(2,2-difluoroethenyl)-4-[4-(4-prop-2-enoxycyclohexyl)cyclohexyl]cyclohexane (PubChem CID 130414821) has the molecular formula C23H36F2O and a molecular weight of 366.54 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)-4-[4-(4-prop-2-enoxycyclohexyl)cyclohexyl]cyclohexane.
| Compound Name | 1-(2,2-difluoroethenyl)-4-[4-(4-prop-2-enoxycyclohexyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 130414821 |
| Molecular Formula | C23H36F2O |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 1-(2,2-difluoroethenyl)-4-[4-(4-prop-2-enoxycyclohexyl)cyclohexyl]cyclohexane |
| SMILES | C=CCOC1CCC(C2CCC(C3CCC(C=C(F)F)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H36F2O/c1-2-15-26-22-13-11-21(12-14-22)20-9-7-19(8-10-20)18-5-3-17(4-6-18)16-23(24)25/h2,16-22H,1,3-15H2 |
| InChIKey | CRGZXPIZMRFYAI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|