C30H48F2O2 — CID 20599509
2-[(E)-2-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-propoxyoxane (PubChem CID 20599509) has the molecular formula C30H48F2O2 and a molecular weight of 478.71 g/mol. Its IUPAC name is 2-[(E)-2-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-propoxyoxane.
| Compound Name | 2-[(E)-2-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-propoxyoxane |
|---|---|
| PubChem CID | 20599509 |
| Molecular Formula | C30H48F2O2 |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 2-[(E)-2-[4-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-propoxyoxane |
| SMILES | CCCOC1CCC(/C=C/C2CCC(C3CCC(C4CCC(C=C(F)F)CC4)CC3)CC2)OC1 |
| InChI | InChI=1S/C30H48F2O2/c1-2-19-33-29-18-17-28(34-21-29)16-7-22-3-8-24(9-4-22)26-12-14-27(15-13-26)25-10-5-23(6-11-25)20-30(31)32/h7,16,20,22-29H,2-6,8-15,17-19,21H2,1H3/b16-7+ |
| InChIKey | XEKGGPLFZPMGPY-FRKPEAEDSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|