C19H32F2O3 — CID 20599552
2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-heptoxy-1,3-dioxane (PubChem CID 20599552) has the molecular formula C19H32F2O3 and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-heptoxy-1,3-dioxane.
| Compound Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-heptoxy-1,3-dioxane |
|---|---|
| PubChem CID | 20599552 |
| Molecular Formula | C19H32F2O3 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-heptoxy-1,3-dioxane |
| SMILES | CCCCCCCOC1COC(C2CCC(C=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C19H32F2O3/c1-2-3-4-5-6-11-22-17-13-23-19(24-14-17)16-9-7-15(8-10-16)12-18(20)21/h12,15-17,19H,2-11,13-14H2,1H3 |
| InChIKey | CROFYNMKMYHPNQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|