C25H43F3O3 — CID 19026629
2-[4-(4-pentoxycyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane (PubChem CID 19026629) has the molecular formula C25H43F3O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[4-(4-pentoxycyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane.
| Compound Name | 2-[4-(4-pentoxycyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19026629 |
| Molecular Formula | C25H43F3O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 2-[4-(4-pentoxycyclohexyl)cyclohexyl]-5-(4,4,4-trifluorobutyl)-1,3-dioxane |
| SMILES | CCCCCOC1CCC(C2CCC(C3OCC(CCCC(F)(F)F)CO3)CC2)CC1 |
| InChI | InChI=1S/C25H43F3O3/c1-2-3-4-16-29-23-13-11-21(12-14-23)20-7-9-22(10-8-20)24-30-17-19(18-31-24)6-5-15-25(26,27)28/h19-24H,2-18H2,1H3 |
| InChIKey | QGGIVEMJUIWXOQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|