C17H30O4 — CID 56622965
4-(5-hexyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 56622965) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-(5-hexyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(5-hexyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 56622965 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4-(5-hexyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCC1COC(C2CCC(C(=O)O)CC2)OC1 |
| InChI | InChI=1S/C17H30O4/c1-2-3-4-5-6-13-11-20-17(21-12-13)15-9-7-14(8-10-15)16(18)19/h13-15,17H,2-12H2,1H3,(H,18,19) |
| InChIKey | FYTVBDIRHUOKEW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|