C30H45NO5 — CID 54020585
(2-cyano-4-heptoxyphenyl) 4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate (PubChem CID 54020585) has the molecular formula C30H45NO5 and a molecular weight of 499.69 g/mol. Its IUPAC name is (2-cyano-4-heptoxyphenyl) 4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (2-cyano-4-heptoxyphenyl) 4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54020585 |
| Molecular Formula | C30H45NO5 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | (2-cyano-4-heptoxyphenyl) 4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCOc1ccc(OC(=O)C2CCC(C3OCC(CCCCC)CO3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C30H45NO5/c1-3-5-7-8-10-18-33-27-16-17-28(26(19-27)20-31)36-29(32)24-12-14-25(15-13-24)30-34-21-23(22-35-30)11-9-6-4-2/h16-17,19,23-25,30H,3-15,18,21-22H2,1-2H3 |
| InChIKey | KYQRZHBGOJBLEJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|